phenyl 4-methylbenzoate
phenyl 4-methylbenzoate structure
|
Common Name | phenyl 4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 1900-85-2 | Molecular Weight | 212.24400 | |
| Density | 1.122g/cm3 | Boiling Point | 342.7ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phenyl 4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 342.7ºC at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 142.4ºC |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 3.21420 |
| Vapour Pressure | 7.42E-05mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | WOHDXQQIBRMRFA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:201230-82-2
CAS#:624-31-7
CAS#:108-95-2
CAS#:104-87-0
CAS#:98-80-6
CAS#:106-38-7
CAS#:1864-94-4
CAS#:99-94-5
CAS#:874-60-2
CAS#:102-09-0
CAS#:134-92-9
CAS#:19434-30-1
CAS#:3128-42-5
CAS#:937-21-3
CAS#:28137-36-2
CAS#:6833-18-7
CAS#:3229-70-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| phenyl p-toluate |
| p-Toluic acid,phenyl ester |
| phenyl p-methylbenzoate |
| Benzoic acid,4-methyl-,phenyl ester |
| 4-Methylbenzoesaeure-phenylester |
| p-methylbenzoic acid phenyl ester |
| 4-methylbenzoic acid phenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of phenyl 4-methylbenzoate? |
| A: Molecular weight of phenyl 4-methylbenzoate is 212.24400. |
| Q: What is the molecular formula of phenyl 4-methylbenzoate? |
| A: Molecular formula of phenyl 4-methylbenzoate is C14H12O2. |
| Q: What English synonyms does phenyl 4-methylbenzoate have? |
| A: English synonyms of phenyl 4-methylbenzoate: phenyl p-toluate, p-Toluic acid,phenyl ester, phenyl p-methylbenzoate, Benzoic acid,4-methyl-,phenyl ester, 4-Methylbenzoesaeure-phenylester, p-methylbenzoic acid phenyl ester, 4-methylbenzoic acid phenyl ester. |
| Q: What are the downstream products of phenyl 4-methylbenzoate? |
| A: Related downstream products(CAS) of phenyl 4-methylbenzoate: 134-92-9;19434-30-1;3128-42-5;937-21-3;99-94-5;108-95-2;104-87-0;28137-36-2;6833-18-7;3229-70-7. |
| Q: What is the polar surface area (PSA) of phenyl 4-methylbenzoate? |
| A: Polar surface area (PSA) of phenyl 4-methylbenzoate is 26.30000. |
| Q: What is the SMILES notation of phenyl 4-methylbenzoate? |
| A: SMILES notation of phenyl 4-methylbenzoate is Cc1ccc(C(=O)Oc2ccccc2)cc1. |
| Q: What are the upstream materials of phenyl 4-methylbenzoate? |
| A: Related upstream materials(CAS) of phenyl 4-methylbenzoate: 201230-82-2;624-31-7;108-95-2;104-87-0;98-80-6;106-38-7;1864-94-4;99-94-5;874-60-2;102-09-0. |
| Q: What is the English name of phenyl 4-methylbenzoate? |
| A: The English name of phenyl 4-methylbenzoate is phenyl 4-methylbenzoate. |
| Q: What is the Chinese name of 1900-85-2? |
| A: Chinese name of 1900-85-2 is 1900-85-2. |
| Q: What is the InChIKey of phenyl 4-methylbenzoate? |
| A: InChIKey of phenyl 4-methylbenzoate is WOHDXQQIBRMRFA-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |