methyl 4-acetamido-3-iodobenzoate
methyl 4-acetamido-3-iodobenzoate structure
|
Common Name | methyl 4-acetamido-3-iodobenzoate | ||
|---|---|---|---|---|
| CAS Number | 190071-23-9 | Molecular Weight | 319.09600 | |
| Density | 1.748g/cm3 | Boiling Point | 444.4ºC at 760 mmHg | |
| Molecular Formula | C10H10INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-acetamido-3-iodobenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.748g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760 mmHg |
| Molecular Formula | C10H10INO3 |
| Molecular Weight | 319.09600 |
| Flash Point | 222.6ºC |
| Exact Mass | 318.97100 |
| PSA | 58.89000 |
| LogP | 2.68570 |
| Vapour Pressure | 4.29E-08mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | XWTQNEZTXKVCML-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(C)=O)c(I)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 2 | |
CAS#:6941-28-2
CAS#:190071-25-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 4-acetamido-3-iodanyl-benzoate |
| 4-acetylamino-3-iodo-benzoic acid methyl ester |
| 3-acetamido-4-iodobenzoic methyl ester |
| AR3230 |
| methyl 4-acetylamino-3-iodobenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl 4-acetamido-3-iodobenzoate? |
| A: InChIKey of methyl 4-acetamido-3-iodobenzoate is XWTQNEZTXKVCML-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 4-acetamido-3-iodobenzoate? |
| A: Molecular weight of methyl 4-acetamido-3-iodobenzoate is 319.09600. |
| Q: What is the English name of methyl 4-acetamido-3-iodobenzoate? |
| A: The English name of methyl 4-acetamido-3-iodobenzoate is methyl 4-acetamido-3-iodobenzoate. |
| Q: What is the CAS number of methyl 4-acetamido-3-iodobenzoate? |
| A: CAS number of methyl 4-acetamido-3-iodobenzoate is 190071-23-9. |
| Q: What is the molecular formula of methyl 4-acetamido-3-iodobenzoate? |
| A: Molecular formula of methyl 4-acetamido-3-iodobenzoate is C10H10INO3. |
| Q: What are the upstream materials of methyl 4-acetamido-3-iodobenzoate? |
| A: Related upstream materials(CAS) of methyl 4-acetamido-3-iodobenzoate: 19718-49-1;75-36-5;108-24-7;150-13-0;2122-63-6;186581-53-3;190071-24-0. |
| Q: What English synonyms does methyl 4-acetamido-3-iodobenzoate have? |
| A: English synonyms of methyl 4-acetamido-3-iodobenzoate: methyl 4-acetamido-3-iodanyl-benzoate, 4-acetylamino-3-iodo-benzoic acid methyl ester, 3-acetamido-4-iodobenzoic methyl ester, AR3230, methyl 4-acetylamino-3-iodobenzoate. |
| Q: What is the SMILES notation of methyl 4-acetamido-3-iodobenzoate? |
| A: SMILES notation of methyl 4-acetamido-3-iodobenzoate is COC(=O)c1ccc(NC(C)=O)c(I)c1. |
| Q: What is the boiling point of methyl 4-acetamido-3-iodobenzoate? |
| A: Boiling point of methyl 4-acetamido-3-iodobenzoate is 444.4ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of methyl 4-acetamido-3-iodobenzoate? |
| A: Polar surface area (PSA) of methyl 4-acetamido-3-iodobenzoate is 58.89000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |