Methyl 2-phenyl-1H-indole-5-carboxylate
Methyl 2-phenyl-1H-indole-5-carboxylate structure
|
Common Name | Methyl 2-phenyl-1H-indole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 190071-25-1 | Molecular Weight | 251.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-phenyl-1H-indole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13NO2 |
|---|---|
| Molecular Weight | 251.28000 |
| Exact Mass | 251.09500 |
| PSA | 42.09000 |
| LogP | 3.62150 |
| InChIKey | QRCCAIGGRLMANJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2[nH]c(-c3ccccc3)cc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![methyl 3-iodo-4-[(2,2,2-trifluoroacetyl)amino]benzoate structure](https://image.chemsrc.com/caspic/042/848485-43-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:110073-82-0This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-phenyl-1H-indole-5-carboxylic acid methyl ester |
| 1H-Indole-5-carboxylic acid,2-phenyl-,methyl ester |
| 2-phenyl-5-indole-carboxylic acid methyl ester |
| 2-phenylindole-5-carboxylic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: InChIKey of Methyl 2-phenyl-1H-indole-5-carboxylate is QRCCAIGGRLMANJ-UHFFFAOYSA-N. |
| Q: What is the LogP of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: LogP of Methyl 2-phenyl-1H-indole-5-carboxylate is 3.62150. |
| Q: What English synonyms does Methyl 2-phenyl-1H-indole-5-carboxylate have? |
| A: English synonyms of Methyl 2-phenyl-1H-indole-5-carboxylate: 2-phenyl-1H-indole-5-carboxylic acid methyl ester, 1H-Indole-5-carboxylic acid,2-phenyl-,methyl ester, 2-phenyl-5-indole-carboxylic acid methyl ester, 2-phenylindole-5-carboxylic acid methyl ester. |
| Q: What is the CAS number of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: CAS number of Methyl 2-phenyl-1H-indole-5-carboxylate is 190071-25-1. |
| Q: What is the molecular formula of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: Molecular formula of Methyl 2-phenyl-1H-indole-5-carboxylate is C16H13NO2. |
| Q: What is the polar surface area (PSA) of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: Polar surface area (PSA) of Methyl 2-phenyl-1H-indole-5-carboxylate is 42.09000. |
| Q: What is the SMILES notation of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: SMILES notation of Methyl 2-phenyl-1H-indole-5-carboxylate is COC(=O)c1ccc2[nH]c(-c3ccccc3)cc2c1. |
| Q: What are the downstream products of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: Related downstream products(CAS) of Methyl 2-phenyl-1H-indole-5-carboxylate: 110073-82-0. |
| Q: What are the upstream materials of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: Related upstream materials(CAS) of Methyl 2-phenyl-1H-indole-5-carboxylate: 848485-43-8;536-74-3;637-44-5;190071-23-9;591-50-4;589-87-7;1011-65-0;2122-63-6;190071-24-0;150-13-0. |
| Q: What is the molecular weight of Methyl 2-phenyl-1H-indole-5-carboxylate? |
| A: Molecular weight of Methyl 2-phenyl-1H-indole-5-carboxylate is 251.28000. |