Eupatoriochromene structure
|
Common Name | Eupatoriochromene | ||
|---|---|---|---|---|
| CAS Number | 19013-03-7 | Molecular Weight | 218.25 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 366.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.4±21.4 °C | |
Use of EupatoriochromeneEupatoriochromene is a chromene and has inhibitory activity against xanthine oxidase (XO)[1][2]. |
| Name | 1-(7-hydroxy-2,2-dimethylchromen-6-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Eupatoriochromene is a chromene and has inhibitory activity against xanthine oxidase (XO)[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.7±42.0 °C at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 |
| Flash Point | 140.4±21.4 °C |
| Exact Mass | 218.094299 |
| PSA | 46.53000 |
| LogP | 4.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | SVUVYHFYZBCYRF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc2c(cc1O)OC(C)(C)C=C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Ethanone, 1-(7-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)- |
| 6-acetyl-7-hydroxy-2,2-dimethylchromene |
| 6-acetyl-7-hydroxy-2,2-dimethyl-3-chromene |
| 7-demethylencecalin |
| Eupatoriochromene |
| 1-(7-hydroxy-2,2-dimethyl-2H-chromen-6-yl)-ethanone |
| 6-acetyl-7-hydroxy-2,2-dimethyl-1H-chromene |
| 1-(7-Hydroxy-2,2-dimethyl-2H-chromen-6-yl)ethanone |
| DEMETHYLENCECALIN |