2-(2,4-dichlorophenoxy)-2-methyl-propanoic acid structure
|
Common Name | 2-(2,4-dichlorophenoxy)-2-methyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1914-66-5 | Molecular Weight | 249.09100 | |
| Density | 1.372g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 2-(2,4-dichlorophenoxy)-2-methylpropanoic acid |
|---|
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09100 |
| Flash Point | 167.4ºC |
| Exact Mass | 248.00100 |
| PSA | 46.53000 |
| LogP | 3.23540 |
| Vapour Pressure | 1.35E-05mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | DVCPZLUILSFNDO-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cc1Cl)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
2-(2,4-dichloro... CAS#:1914-66-5 |
| Literature: Chugai Seiyaku Kabushiki Kaisha Patent: EP2433940 A1, 2012 ; Location in patent: Page/Page column 171 ; |
|
~%
2-(2,4-dichloro... CAS#:1914-66-5 |
| Literature: Chugai Seiyaku Kabushiki Kaisha Patent: EP2433940 A1, 2012 ; |
|
~%
2-(2,4-dichloro... CAS#:1914-66-5 |
| Literature: Joensson Acta Chemica Scandinavica (1947-1973), 1953 , vol. 7, p. 596,599 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |