1-tert-butyl 3-ethyl piperidine-1,3-dicarboxylate structure
|
Common Name | 1-tert-butyl 3-ethyl piperidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 191599-51-6 | Molecular Weight | 257.326 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 323.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | 35-40ºC | |
| MSDS | Chinese USA | Flash Point | 149.7±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.9±35.0 °C at 760 mmHg |
| Melting Point | 35-40ºC |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.326 |
| Flash Point | 149.7±25.9 °C |
| Exact Mass | 257.162720 |
| PSA | 55.84000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | YCXCRFGBFZTUSU-JTQLQIEISA-N |
| SMILES | CCOC(=O)C1CCCN(C(=O)OC(C)(C)C)C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R26;R36 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~85%
1-tert-butyl 3-... CAS#:191599-51-6 |
| Literature: Slusarchyk, William A.; Bolton, Scott A.; Hartl, Karen S.; Huang, Ming-Hsing; Jacobs, Glenn; Meng, Wei; Ogletree, Martin L.; Pi, Zulan; Schumacher, William A.; Seiler, Steven M.; Sutton, James C.; Treuner, Uwe; Zahler, Robert; Zhao, Guohua; Bisacchi, Gregory S. Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 21 p. 3235 - 3238 |
|
~%
1-tert-butyl 3-... CAS#:191599-51-6 |
| Literature: US5817678 A1, ; US 5817678 A |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-tert-butyl 3-ethyl piperidine-1,3-dicarboxylate |
| 3-Ethyl 1-(2-methyl-2-propanyl) 1,3-piperidinedicarboxylate |
| Ethyl 1-Boc-L-nipecotate |
| 1,3-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) 3-ethyl ester |
| 1-(Tert-Butyl) 3-Ethyl Tetrahydro-1,3(2H)-Pyridinedicarboxylate |