Ethyl (R)-1-Boc-nipecotate structure
|
Common Name | Ethyl (R)-1-Boc-nipecotate | ||
|---|---|---|---|---|
| CAS Number | 194726-40-4 | Molecular Weight | 257.326 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 323.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | 37 °C | |
| MSDS | Chinese USA | Flash Point | 149.7±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-O-tert-butyl 3-O-ethyl (3R)-piperidine-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.9±35.0 °C at 760 mmHg |
| Melting Point | 37 °C |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.326 |
| Flash Point | 149.7±25.9 °C |
| Exact Mass | 257.162720 |
| PSA | 55.84000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | YCXCRFGBFZTUSU-SNVBAGLBSA-N |
| SMILES | CCOC(=O)C1CCCN(C(=O)OC(C)(C)C)C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
|
~%
Ethyl (R)-1-Boc... CAS#:194726-40-4 |
| Literature: European Journal of Organic Chemistry, , # 19 p. 4343 - 4347 |
|
~%
Ethyl (R)-1-Boc... CAS#:194726-40-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 12, # 21 p. 3235 - 3238 |
|
~%
Ethyl (R)-1-Boc... CAS#:194726-40-4 |
| Literature: European Journal of Organic Chemistry, , # 19 p. 4343 - 4347 |
|
~%
Ethyl (R)-1-Boc... CAS#:194726-40-4 |
| Literature: European Journal of Organic Chemistry, , # 19 p. 4343 - 4347 |
| 1-tert-butyl 3-ethyl piperidine-1,3-dicarboxylate |
| 3-Ethyl 1-(2-methyl-2-propanyl) 1,3-piperidinedicarboxylate |
| (R)-1-tert-Butyl 3-ethyl piperidine-1,3-dicarboxylate |
| 1,3-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) 3-ethyl ester |
| Ethyl (R)-1-Boc-3-piperidinecarboxylate |
| (R)-1-(tert-Butoxycarbonyl)-3-piperidinecarboxylic Acid Ethyl Ester |
| 1-(Tert-Butyl) 3-Ethyl Tetrahydro-1,3(2H)-Pyridinedicarboxylate |
| (R)-1-Boc-nipecotic Acid Ethyl Ester |
| (R)-1-Boc-3-piperidinecarboxylic Acid Ethyl Ester |
| Ethyl (R)-1-Boc-nipecotate |
| Ethyl (R)-1-(tert-Butoxycarbonyl)-3-piperidinecarboxylate |
| Ethyl (R)-1-(tert-Butoxycarbonyl)nipecotate |