4-Chloro-N-(4-hydroxyphenyl)benzamide structure
|
Common Name | 4-Chloro-N-(4-hydroxyphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 19207-92-2 | Molecular Weight | 247.67700 | |
| Density | 1.386g/cm3 | Boiling Point | 342.6ºC at 760mmHg | |
| Molecular Formula | C13H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161ºC | |
| Name | 4-Chloro-N-(4-hydroxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 342.6ºC at 760mmHg |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.67700 |
| Flash Point | 161ºC |
| Exact Mass | 247.04000 |
| PSA | 52.82000 |
| LogP | 3.68190 |
| Vapour Pressure | 3.76E-05mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | NBFVHUUXPNDPDO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4-chloro-benzoylamino)-phenol |