4-Chloro-N-(4-methoxyphenyl)benzamide structure
|
Common Name | 4-Chloro-N-(4-methoxyphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 4018-82-0 | Molecular Weight | 261.704 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 328.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | 208-209 °C | |
| MSDS | N/A | Flash Point | 152.7±23.7 °C | |
| Name | 4-chloro-N-(4-methoxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.8±27.0 °C at 760 mmHg |
| Melting Point | 208-209 °C |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.704 |
| Flash Point | 152.7±23.7 °C |
| Exact Mass | 261.055664 |
| PSA | 38.33000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | UVGPQLMHIRNFEE-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-chloro-benzoic acid p-anisidide |
| 4-Chlor-benzoesaeure-p-anisidid |
| Benzamide, 4-chloro-N-(4-methoxyphenyl)- |
| N-(p-Chlorobenzoyl)-p-anisidine |
| 4-chloro-N-(4-methoxyphenyl)-benzamide |
| 4-CHLORO-N-(4-METHOXY-PHENYL)-BENZAMIDE |
| 4-Chloro-N-(4-methoxyphenyl)benzamide |
| benzamide,4-chloro-n-(4-methoxyphenyl) |