(22E)-Ergosta-4,6,8(14),22-tetraen-3-one structure
|
Common Name | (22E)-Ergosta-4,6,8(14),22-tetraen-3-one | ||
|---|---|---|---|---|
| CAS Number | 19254-69-4 | Molecular Weight | 392.617 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 523.5±30.0 °C at 760 mmHg | |
| Molecular Formula | C28H40O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.5±15.4 °C | |
Use of (22E)-Ergosta-4,6,8(14),22-tetraen-3-oneErgosta-4,6,8(14),22-tetraen-3-one (compound 2) is a ergosteroid is isolated from the fruiting bodies of ganoderma applanatum[1]. |
| Name | ergosta-4,6,8(14),22-tetraen-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ergosta-4,6,8(14),22-tetraen-3-one (compound 2) is a ergosteroid is isolated from the fruiting bodies of ganoderma applanatum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 523.5±30.0 °C at 760 mmHg |
| Molecular Formula | C28H40O |
| Molecular Weight | 392.617 |
| Flash Point | 263.5±15.4 °C |
| Exact Mass | 392.307922 |
| PSA | 17.07000 |
| LogP | 8.45 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | OIMXTYUHMBQQJM-HSVWHVBGSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2=C3C=CC4=CC(=O)CCC4(C)C3CCC21C |
| Hazard Codes | Xi |
|---|
| Ergosta-4,6,8(14),22-tetraen-3-one, (22E)- |
| (22E)-Ergosta-4,6,8(14),22-tetraen-3-one |
| (9R,10R,13R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| W2324 |