Vanillin-4-nitrophenylhydrazon
Modify Date: 2025-11-25 18:43:05
Vanillin-4-nitrophenylhydrazon structure
|
Common Name | Vanillin-4-nitrophenylhydrazon | ||
|---|---|---|---|---|
| CAS Number | 19258-30-1 | Molecular Weight | 287.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Vanillin-4-nitrophenylhydrazon |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13N3O4 |
|---|---|
| Molecular Weight | 287.27100 |
| Exact Mass | 287.09100 |
| PSA | 99.67000 |
| LogP | 3.35120 |
| InChIKey | QQIDWQSZAGABAG-OQLLNIDSSA-N |
| SMILES | COc1cc(C=NNc2ccc([N+](=O)[O-])cc2)ccc1O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-HYDROXY-3-METHOXYBENZALDEHYDE (4-NITROPHENYL)HYDRAZONE |
| 3-Methoxy-4-hydroxy-benzaldehyd-4-nitrophenylhydrazon |
| 4-Oxy-3-methoxy-benzaldehyd-(4-nitro-phenylhydrazon) |
| vanillin-(4-nitro-phenylhydrazone) |
| Vanillin-4-nitro-phenylhydrazon |
| Vanillin-(4-nitro-phenylhydrazon) |