Ethyl 3-amino-2-nitrobenzoate structure
|
Common Name | Ethyl 3-amino-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 193014-01-6 | Molecular Weight | 210.187 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 364.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3±22.3 °C | |
| Name | Ethyl 3-amino-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.6±22.0 °C at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.187 |
| Flash Point | 174.3±22.3 °C |
| Exact Mass | 210.064056 |
| PSA | 98.14000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | IJNYIIHVEXLJGI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(N)c1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
|
~%
Ethyl 3-amino-2... CAS#:193014-01-6 |
| Literature: Fujisawa Pharmaceutical Co., Ltd. Patent: US6166219 A1, 2000 ; |
|
~%
Ethyl 3-amino-2... CAS#:193014-01-6 |
| Literature: Fujisawa Pharmaceutical Co., Ltd. Patent: US6352985 B1, 2002 ; Location in patent: Page column 65 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Ethyl 3-amino-2-nitrobenzoate |
| 3-Amino-2-nitro-benzoesaeure-aethylester |
| Benzoic acid, 3-amino-2-nitro-, ethyl ester |
| 3-amino-2-nitro-benzoic acid ethyl ester |