tert-butyl 3-benzyl-4-oxopiperidine-1-carboxylate structure
|
Common Name | tert-butyl 3-benzyl-4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 193274-82-7 | Molecular Weight | 289.36900 | |
| Density | 1.115g/cm3 | Boiling Point | 409ºC at 760mmHg | |
| Molecular Formula | C17H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | tert-butyl 3-benzyl-4-oxopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 409ºC at 760mmHg |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.36900 |
| Flash Point | 201.2ºC |
| Exact Mass | 289.16800 |
| PSA | 46.61000 |
| LogP | 2.99310 |
| Vapour Pressure | 6.69E-07mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | UXRKAOUQKRGROB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)CC2=CC=CC=C2 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~87%
tert-butyl 3-be... CAS#:193274-82-7 |
| Literature: Takeda Pharmaceutical Company Limited Patent: EP1553084 A1, 2005 ; Location in patent: Page/Page column 54 ; |
|
~%
tert-butyl 3-be... CAS#:193274-82-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 20 p. 5704 - 5708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-benzyl-4-oxopiperidine-1-carboxylic acid tert-butyl ester |