FLUORESCEIN O-ACRYLATE structure
|
Common Name | FLUORESCEIN O-ACRYLATE | ||
|---|---|---|---|---|
| CAS Number | 193419-86-2 | Molecular Weight | 370.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H14O5 | Melting Point | 231-233ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 231-233ºC(lit.) |
|---|---|
| Molecular Formula | C23H14O5 |
| Molecular Weight | 370.35400 |
| Exact Mass | 370.08400 |
| PSA | 61.83000 |
| LogP | 4.34600 |
| InChIKey | VYLDMXSRCVCHNE-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H411 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Hazard Codes | Xi,N |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 3077 9/PG 3 |
|
~79%
FLUORESCEIN O-A... CAS#:193419-86-2 |
| Literature: Wang, Huilin; Zhou, Guodong; Gai, Hongwei; Chen, Xiaoqiang Chemical Communications, 2012 , vol. 48, # 67 p. 8341 - 8343 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Interfacial assembly of dendritic microcapsules with host-guest chemistry.
Nat. Commun. 5 , 5772, (2014) The self-assembly of nanoscale materials to form hierarchically ordered structures promises new opportunities in drug delivery, as well as magnetic materials and devices. Herein, we report a simple me... |
|
|
Design of Environmentally Responsive Fluorescent Polymer Probes for Cellular Imaging.
Biomacromolecules 16 , 2356-62, (2015) We report the development of environmentally responsive fluorescent polymers. The reversible temperature-induced phase transition of copolymers composed of N-isopropylacrylamide and a fluorescent mono... |
| Fluorescein o-acrylate |
| 3'-Acryloxyspirobenzo[c]-furan[1,9']xanthen-3-one |
| 3 inverted exclamation mark-Acryloxyspirobenzo[c]-furan[1,9 inverted exclamation mark ]xanthen-3-one |
| Acryloyloxy fluorescein |