Ethanol,2-[[(4-nitrophenyl)methylene]amino]- structure
|
Common Name | Ethanol,2-[[(4-nitrophenyl)methylene]amino]- | ||
|---|---|---|---|---|
| CAS Number | 19394-08-2 | Molecular Weight | 194.18700 | |
| Density | 1.24g/cm3 | Boiling Point | 358ºC at 760mmHg | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | 2-[(4-nitrophenyl)methyleneamino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 358ºC at 760mmHg |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Flash Point | 170.3ºC |
| Exact Mass | 194.06900 |
| PSA | 78.41000 |
| LogP | 1.52920 |
| Vapour Pressure | 9.5E-06mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | WOEUSDIWFMCJSY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=NCCO)cc1 |
|
~96%
Ethanol,2-[[(4-... CAS#:19394-08-2 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 10 p. 2025 - 2030 |
| [4-(4-fluoro-phenyl)-thiazol-2-yl]-(4-nitro-benzylidene)-amine |
| 2-(4-Nitro-benzylidenamino)-aethanol |
| p-Nitro-benzyliden-ethanol-amin |
| 2-(4'-Nitro-benzylidenamino)-4-(4'-fluor-phenyl)-thiazol |
| 2-(4-nitro-benzylidenamino)-ethanol |
| 2-(p-Nitrobenzylidenamino)ethanol |
| 2-Thiazolamine,4-(4-fluorophenyl)-N-[(4-nitrophenyl)methylene] |