(R/S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID structure
|
Common Name | (R/S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID | ||
|---|---|---|---|---|
| CAS Number | 195202-06-3 | Molecular Weight | 254.27900 | |
| Density | 1.142g/cm3 | Boiling Point | 378.9ºC at 760mmHg | |
| Molecular Formula | C13H18O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 138.7ºC | |
| Name | (r/s)-2-(3,4,5-trimethoxyphenyl)butyric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 378.9ºC at 760mmHg |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.27900 |
| Flash Point | 138.7ºC |
| Exact Mass | 254.11500 |
| PSA | 64.99000 |
| LogP | 2.29060 |
| Vapour Pressure | 2.05E-06mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | WBULUDGUWZFLMO-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)c1cc(OC)c(OC)c(OC)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|
|
~83%
(R/S)-2-(3,4,5-... CAS#:195202-06-3 |
| Literature: Ariad Gene Therapeutics, Inc. Patent: US6566073 B1, 2003 ; |
|
~%
(R/S)-2-(3,4,5-... CAS#:195202-06-3 |
| Literature: Yang, Wu; Rozamus, Leonard W.; Narula, Surinder; Rollins, Carl T.; Yuan, Ruth; Andrade, Lawrence J.; Ram, Mary K.; Phillips, Thomas B.; Van Schravendijk, Marie Rose; Dalgarno, David; Clackson, Tim; Holt, Dennis A. Journal of Medicinal Chemistry, 2000 , vol. 43, # 6 p. 1135 - 1142 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Buibuilactone |