DBO-83 structure
|
Common Name | DBO-83 | ||
|---|---|---|---|---|
| CAS Number | 195211-53-1 | Molecular Weight | 297.61200 | |
| Density | N/A | Boiling Point | 496.3ºC at 760 mmHg | |
| Molecular Formula | C10H15Cl3N4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 253.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of DBO-83DBO-83 is an agonist of nicotinic acetylcholine receptors (nAChRs) with antinociceptive and anti-amnesic activities. |
| Name | (1R,5S)-3-(6-chloropyridazin-3-yl)-3,8-diazabicyclo[3.2.1]octane,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 496.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H15Cl3N4 |
| Molecular Weight | 297.61200 |
| Flash Point | 253.9ºC |
| Exact Mass | 296.03600 |
| PSA | 41.05000 |
| LogP | 3.06840 |
| Vapour Pressure | 3.13E-10mmHg at 25°C |
| InChIKey | FMBGHZXNKMHVDT-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Clc1ccc(N2CC3CCC(C2)N3)nn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
|
Neuronal nicotinic acetylcholine receptors as novel drug targets.
J. Pharmacol. Exp. Ther. 292 , 461-467, (2000)
|
|
|
Ghelardini, C., et al.
Drug Dev. Res. 40 , 251-258, (1997)
|
| DBO-83 |
| 3-(6-Chloro-3-pyridazinyl)-3,8-diazabicyclo[3.2.1]octane dihydrochloride |