SJ-3366 structure
|
Common Name | SJ-3366 | ||
|---|---|---|---|---|
| CAS Number | 195720-26-4 | Molecular Weight | 352.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SJ-3366SJ-3366 (IQP-0410) is a potent inhibitor of HIV nonnucleoside reverse transcriptase[1]. SJ-3366 (IQP-0410) inhibits HIV at sub-nanomolar concentrations primarily through a typical non-nucleoside mechanism[2]. |
| Name | 1-(cyclopent-3-en-1-ylmethyl)-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | SJ-3366 (IQP-0410) is a potent inhibitor of HIV nonnucleoside reverse transcriptase[1]. SJ-3366 (IQP-0410) inhibits HIV at sub-nanomolar concentrations primarily through a typical non-nucleoside mechanism[2]. |
|---|---|
| Related Catalog | |
| Target |
nonnucleoside reverse transcriptase[1] |
| References |
| Molecular Formula | C21H24N2O3 |
|---|---|
| Molecular Weight | 352.42700 |
| Exact Mass | 352.17900 |
| PSA | 72.19000 |
| LogP | 3.32530 |
| InChIKey | BEMROAADXJFLBI-UHFFFAOYSA-N |
| SMILES | CCc1c(C(=O)c2cc(C)cc(C)c2)n(CC2CC=CC2)c(=O)[nH]c1=O |
| Hazard Codes | Xi |
|---|
| IQP0410 |
| Nab 2F5 |
| Nab 2G12 |
| SJ-3366 |