ANGELOL-A structure
|
Common Name | ANGELOL-A | ||
|---|---|---|---|---|
| CAS Number | 19625-17-3 | Molecular Weight | 376.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O7 | Melting Point | 104-105 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of ANGELOL-AAngelol A is a coumarin isolated from the roots of Angelica pubescens f. biserrata, which is passive diffusion as the dominating process in Caco-2 cell monolayer model[1]. |
| Name | angelol A |
|---|---|
| Synonym | More Synonyms |
| Description | Angelol A is a coumarin isolated from the roots of Angelica pubescens f. biserrata, which is passive diffusion as the dominating process in Caco-2 cell monolayer model[1]. |
|---|---|
| Related Catalog |
| Melting Point | 104-105 °C |
|---|---|
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.40000 |
| Exact Mass | 376.15200 |
| PSA | 106.20000 |
| LogP | 2.48390 |
| InChIKey | GFMYIOGFYYHKLA-PWZGUCPHSA-N |
| SMILES | CC=C(C)C(=O)OC(C(O)c1cc2ccc(=O)oc2cc1OC)C(C)(C)O |
| Hazard Codes | Xi |
|---|
| angelol B |
| (Z)-2-Methyl-but-2-enoic acid (S)-2-hydroxy-1-[(R)-hydroxy-(7-methoxy-2-oxo-2H-chromen-6-yl)-methyl]-2-methyl-propyl ester |