2,3-Diphenyl-1H-indole-7-carboxylic acid structure
|
Common Name | 2,3-Diphenyl-1H-indole-7-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 197313-74-9 | Molecular Weight | 313.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-Diphenyl-1H-indole-7-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H15NO2 |
|---|---|
| Molecular Weight | 313.34900 |
| Exact Mass | 313.11000 |
| PSA | 53.09000 |
| LogP | 5.20010 |
| InChIKey | OLUDUXWVPIEHDA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c(-c3ccccc3)c(-c3ccccc3)[nH]c12 |
|
~24%
2,3-Diphenyl-1H... CAS#:197313-74-9 |
| Literature: BIOVITRUM AB Patent: WO2004/63156 A1, 2004 ; Location in patent: Page 43-44 ; WO 2004/063156 A1 |
|
~%
2,3-Diphenyl-1H... CAS#:197313-74-9 |
| Literature: Coldham et al. Journal of the Chemical Society, 1954 , p. 4528,4530 |
| HMS2757D14 |
| 2,3-diphenyl-indole-7-carboxylic acid |
| diphenylindole carboxylic acid,3 |
| 2,3-Diphenyl-indol-7-carbonsaeure |