4-(Adamantan-1-yl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(Adamantan-1-yl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 19735-74-1 | Molecular Weight | 234.360 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 390.9±11.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 190.2±19.3 °C | |
Use of 4-(Adamantan-1-yl)-1,3-thiazol-2-amine2-amino-4-(1-adamantyl) Thiazole is a synthetic intermediate useful for pharmaceutical synthesis. |
| Name | 4-(1-adamantyl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.9±11.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.360 |
| Flash Point | 190.2±19.3 °C |
| Exact Mass | 234.119064 |
| PSA | 67.15000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | JVJWJUQLRDIVJV-UHFFFAOYSA-N |
| SMILES | Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934100090 |
|
~93%
4-(Adamantan-1-... CAS#:19735-74-1 |
| Literature: Omar, Kouatli; Geronikaki, Athina; Zoumpoulakis, Panagiotis; Camoutsis, Charalabos; Sokovic, Marina; Ciric, Ana; Glamoclija, Jasmina Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 1 p. 426 - 432 |
|
~%
4-(Adamantan-1-... CAS#:19735-74-1 |
| Literature: Journal of Organic Chemistry, , vol. 63, # 1 p. 196 - 200 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(adamant-1-yl)thiazol-2-ylamine |
| 4-(1-adamantyl)-2-aminothiazole |
| 4-adamantanyl-1,3-thiazole-2-ylamine |
| 2-Thiazolamine, 4-tricyclo[3.3.1.1]dec-1-yl- |
| 4-(Adamantan-1-yl)-1,3-thiazol-2-amine |
| 4-(tricyclo[3.3.1.1~3,7~]dec-1-yl)-1,3-thiazol-2-amine |
| 4-[(3s,5s,7s)-Adamantan-1-yl]-1,3-thiazol-2-amine |
| 4-adamantyl-2-aminothiazole |
| 4-(adamantan-1-yl)thiazol-2-amine |
| 4-Adamantan-1-yl-thiazol-2-ylamine |