9H-Fluoren-9-ylmethyl carbonisothiocyanatidate structure
|
Common Name | 9H-Fluoren-9-ylmethyl carbonisothiocyanatidate | ||
|---|---|---|---|---|
| CAS Number | 199915-38-3 | Molecular Weight | 281.329 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 433.1±14.0 °C at 760 mmHg | |
| Molecular Formula | C16H11NO2S | Melting Point | 42-46ºC | |
| MSDS | Chinese USA | Flash Point | 215.7±20.1 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.1±14.0 °C at 760 mmHg |
| Melting Point | 42-46ºC |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.329 |
| Flash Point | 215.7±20.1 °C |
| Exact Mass | 281.051056 |
| PSA | 70.75000 |
| LogP | 5.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | DHMYULZVFHHEHE-UHFFFAOYSA-N |
| SMILES | O=C(N=C=S)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | -20°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2930909090 |
|
~99%
9H-Fluoren-9-yl... CAS#:199915-38-3 |
| Literature: Journal of Organic Chemistry, , vol. 65, # 5 p. 1566 - 1568 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Solid-Phase Synthesis of 2-Aminothiazoles.
J. Org. Chem. 63 , 196, (1998)
|
| 9-Fluorenylmethyl isothiocyanatoformate |
| Carbonisothiocyanatidic acid, 9H-fluoren-9-ylmethyl ester |
| FMOC isothiocyanate |
| N-Fmoc-isothiocyanate |
| fluorenylmethyloxycarbonyl isothiocyanate |
| N-Fmoc-thioisocyanate |
| Fmoc-isothiocyanate |
| 9-Fluorenylmethoxycarbonylisothiocyanate |
| 9H-Fluoren-9-ylmethyl carbonisothiocyanatidate |