3,5-Dichlorobenzenesulfonamide structure
|
Common Name | 3,5-Dichlorobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 19797-32-1 | Molecular Weight | 226.080 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 395.6±52.0 °C at 760 mmHg | |
| Molecular Formula | C6H5Cl2NO2S | Melting Point | 161-165 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 193.1±30.7 °C | |
| Name | 3,5-Dichlorobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.6±52.0 °C at 760 mmHg |
| Melting Point | 161-165 °C(lit.) |
| Molecular Formula | C6H5Cl2NO2S |
| Molecular Weight | 226.080 |
| Flash Point | 193.1±30.7 °C |
| Exact Mass | 224.941803 |
| PSA | 68.54000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | AHNOVNYOUPQVRX-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DB1670000 |
|
~99%
3,5-Dichloroben... CAS#:19797-32-1 |
| Literature: GLAXO GROUP LIMITED Patent: WO2004/113280 A1, 2004 ; Location in patent: Page/Page column 24; 25 ; WO 2004/113280 A1 |
| 3,5-dichlorobenzene-1-sulfonamide |
| 3,5-dichlorophenylsulphonamide |
| Benzenesulfonamide, 3,5-dichloro- |
| 3,5-dichloro-benzenesulfonamide |
| MFCD00117161 |
| 3,5-Dichlorobenzenesulfonamide |
| 3.5-Dichlor-benzolsulfonsaeure-amid |