4,6-Dihydroxyisophthalic acid structure
|
Common Name | 4,6-Dihydroxyisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 19829-74-4 | Molecular Weight | 198.130 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 551.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.1±22.4 °C | |
| Name | 4,6-dihydroxybenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 551.0±35.0 °C at 760 mmHg |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.130 |
| Flash Point | 301.1±22.4 °C |
| Exact Mass | 198.016434 |
| PSA | 115.06000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | MZGVIIXFGJCRDR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)c(O)cc1O |
| HS Code | 2918290000 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4.6-Dioxy-benzol-dicarbonsaeure-(1.3) |
| 4,6-Dihydroxyisophthalic acid |
| Resorcin-dicarbonsaeure-(4.6) |
| 4,6-DIHYDROXY-ISOPHTHALIC ACID |
| 4,6-Dihydroxy-isophthalsaeure |
| 4,6-dihydroxy-1,3-benzenedicarboxylic acid |