Medicagol structure
|
Common Name | Medicagol | ||
|---|---|---|---|---|
| CAS Number | 1983-72-8 | Molecular Weight | 296.23100 | |
| Density | 1.644g/cm3 | Boiling Point | 552.6ºC at 760mmHg | |
| Molecular Formula | C16H8O6 | Melting Point | >300℃ | |
| MSDS | N/A | Flash Point | 288ºC | |
Use of MedicagolMedicagol, is a natural compound isolated from Medicago sativa[1]. |
| Name | Medicagol |
|---|---|
| Synonym | More Synonyms |
| Description | Medicagol, is a natural compound isolated from Medicago sativa[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.644g/cm3 |
|---|---|
| Boiling Point | 552.6ºC at 760mmHg |
| Melting Point | >300℃ |
| Molecular Formula | C16H8O6 |
| Molecular Weight | 296.23100 |
| Flash Point | 288ºC |
| Exact Mass | 296.03200 |
| PSA | 82.04000 |
| LogP | 3.12670 |
| Vapour Pressure | 8.08E-13mmHg at 25°C |
| Index of Refraction | 1.754 |
| InChIKey | URMVEUAWRUQHON-UHFFFAOYSA-N |
| SMILES | O=c1oc2cc(O)ccc2c2oc3cc4c(cc3c12)OCO4 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Hydroxy-11,12-methylenedioxycoumestan |
| 6H-(1,3)Dioxolo(5,6)benzofuro(3.2-c)(1)benzopyran-6-one,3-hydroxy |
| 3-Hydroxy-8,9-methylenedioxycoumestan |