Furanodiene structure
|
Common Name | Furanodiene | ||
|---|---|---|---|---|
| CAS Number | 19912-61-9 | Molecular Weight | 216.31900 | |
| Density | 0.945±0.06 g/cm3 | Boiling Point | 309.6±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O | Melting Point | 74-75 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of FuranodieneFuranodiene is a natural terpenoid isolated from Rhizoma Curcumae. Furanodiene plays anti-cancer effects through anti-angiogenesis and inducing ROS production, DNA strand breaks and apoptosis. Furanodiene suppresseed efflux transporter Pgp (P-glycoprotein) function and reduced Pgp protein level[1]. |
| Name | furanodiene |
|---|---|
| Synonym | More Synonyms |
| Description | Furanodiene is a natural terpenoid isolated from Rhizoma Curcumae. Furanodiene plays anti-cancer effects through anti-angiogenesis and inducing ROS production, DNA strand breaks and apoptosis. Furanodiene suppresseed efflux transporter Pgp (P-glycoprotein) function and reduced Pgp protein level[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Furanodiene (1.4, 4.1, 12.2 uM; 48 hours) is effective in treating human JF 305 pancreatic cancer cells and MCF-7 breast cancer cells xenotranplanted into the zebrafish[1]. Furanodiene has no effect on Pgp related gene (MDR1) expression[1]. |
| References |
| Density | 0.945±0.06 g/cm3 |
|---|---|
| Boiling Point | 309.6±11.0 °C at 760 mmHg |
| Melting Point | 74-75 °C |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.31900 |
| Exact Mass | 216.15100 |
| PSA | 13.14000 |
| LogP | 4.35940 |
| InChIKey | VMDXHYHOJPKFEK-HZAVHUKASA-N |
| SMILES | CC1=CCc2c(C)coc2CC(C)=CCC1 |
| cyclodeca(b)furan, 4,7,8,11-tetrahydro-3,6,10-trimethyl-, (5e,9z)- |