1-(4-Fluorobenzyl)piperazine dihydrochloride structure
|
Common Name | 1-(4-Fluorobenzyl)piperazine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 199672-06-5 | Molecular Weight | 267.171 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17Cl2FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-(4-Fluorobenzyl)piperazine dihydrochloride4-fluoro BZP hydrochloride is a substituted BZP with a potential for abuse. |
| Name | 1-[(4-fluorophenyl)methyl]piperazine,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17Cl2FN2 |
|---|---|
| Molecular Weight | 267.171 |
| Exact Mass | 266.075287 |
| PSA | 15.27000 |
| LogP | 3.10160 |
| InChIKey | LEYGHHPTNYWQEF-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Fc1ccc(CN2CCNCC2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Fluorobenzyl)piperazine dihydrochloride |
| Piperazine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:2) |
| 1-(4-Fluoro-benzyl)-piperazine 2HCl |