1-(4-Methoxyphenyl)piperazine dihydrochloride structure
|
Common Name | 1-(4-Methoxyphenyl)piperazine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 38869-47-5 | Molecular Weight | 265.179 | |
| Density | N/A | Boiling Point | 344ºC at 760 mmHg | |
| Molecular Formula | C11H18Cl2N2O | Melting Point | 240 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 161.8ºC | |
| Name | 1-(4-Methoxyphenyl)piperazine Dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 344ºC at 760 mmHg |
|---|---|
| Melting Point | 240 °C (dec.)(lit.) |
| Molecular Formula | C11H18Cl2N2O |
| Molecular Weight | 265.179 |
| Flash Point | 161.8ºC |
| Exact Mass | 264.079620 |
| PSA | 24.50000 |
| LogP | 3.10260 |
| InChIKey | MMXANKLJIHSIQH-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCNCC2)cc1.Cl.Cl |
| Storage condition | -20°C Freezer |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S28A-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~%
1-(4-Methoxyphe... CAS#:38869-47-5 |
| Literature: Xiao, Zhihui; Yuan, Mu; Zhang, Si; Wu, Jun; Qi, Shuhua; Li, Qingxin Magnetic Resonance in Chemistry, 2005 , vol. 43, # 10 p. 869 - 872 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-methoxyphenyl)piperazine,dihydrochloride |
| MFCD00012767 |
| 1-(4-Methoxyphenyl)piperazine, hydrochloride (1:2) |
| Piperazine, 1-(4-methoxyphenyl)-, hydrochloride (1:2) |
| T6M DNTJ DR DO1 &&2HCl |
| 1-(4-Methoxyphenyl)piperazine dihydrochloride |
| EINECS 254-166-6 |
| 4-(1-Piperazinyl)anisole Dihydrochloride |
| Piperazine, 1- (4-methoxyphenyl)-, dihydrochloride |