ZCZ011 structure
|
Common Name | ZCZ011 | ||
|---|---|---|---|---|
| CAS Number | 1998197-39-9 | Molecular Weight | 362.44 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 602.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.4±31.5 °C | |
Use of ZCZ011ZCZ011 is a potent and brain penetrant cannabinoid 1 (CB1) receptor positive allosteric modulator. ZCZ011 potentiates binding of CP55,940 to the CB1 receptor, enhances anandamide (AEA)-stimulated GTPγS binding in mouse brain membranes. ZCZ011 increases β-arrestin recruitment and ERK phosphorylation in hCB1 cells. ZCZ011 can be used for researching neuropathic and inflammatory pain[1]. |
| Name | ZCZ-011 |
|---|---|
| Synonym | More Synonyms |
| Description | ZCZ011 is a potent and brain penetrant cannabinoid 1 (CB1) receptor positive allosteric modulator. ZCZ011 potentiates binding of CP55,940 to the CB1 receptor, enhances anandamide (AEA)-stimulated GTPγS binding in mouse brain membranes. ZCZ011 increases β-arrestin recruitment and ERK phosphorylation in hCB1 cells. ZCZ011 can be used for researching neuropathic and inflammatory pain[1]. |
|---|---|
| Related Catalog | |
| Target |
CB1[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.8±55.0 °C at 760 mmHg |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.44 |
| Flash Point | 318.4±31.5 °C |
| Exact Mass | 362.108887 |
| LogP | 6.37 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | RJSPNRDBWHHFMH-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(C(C[N+](=O)[O-])c3cccs3)c(-c3ccccc3)[nH]c2c1 |
| Hazard Codes | Xi |
|---|
| ZCZ011 |
| 1H-Indole, 6-methyl-3-[2-nitro-1-(2-thienyl)ethyl]-2-phenyl- |
| ZCZ-011 |
| 6-Methyl-3-[2-nitro-1-(2-thienyl)ethyl]-2-phenyl-1H-indole |