5-(2-ETHOXY-PHENYL)-4H-[1,2,4]TRIAZOLE-3-THIOL structure
|
Common Name | 5-(2-ETHOXY-PHENYL)-4H-[1,2,4]TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 19982-35-5 | Molecular Weight | 221.27900 | |
| Density | 1.34g/cm3 | Boiling Point | 332.7ºC at 760mmHg | |
| Molecular Formula | C10H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155ºC | |
| Name | 5-(2-ethoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 332.7ºC at 760mmHg |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.27900 |
| Flash Point | 155ºC |
| Exact Mass | 221.06200 |
| PSA | 89.60000 |
| LogP | 2.15910 |
| Vapour Pressure | 0.000143mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | DAAVINWNKVQDMO-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1-c1nc(=S)[nH][nH]1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Mercapto-3-(2-ethoxy-phenyl)-4H-1,2,4-triazol |
| 5-(2-Ethoxyphenyl)-4H-1,2,4-triazole-3-thiol |
| 3-Mercapto-5-(2-ethoxy-phenyl)-4H-1,2,4-triazol |
| 5-(2-ethoxy-phenyl)-1,2-dihydro-[1,2,4]triazole-3-thione |