N-Arachidonoyl dopamine structure
|
Common Name | N-Arachidonoyl dopamine | ||
|---|---|---|---|---|
| CAS Number | 199875-69-9 | Molecular Weight | 439.630 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 640.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H41NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 340.8±31.5 °C | |
Use of N-Arachidonoyl dopamineN-Arachidonyldopamine is a potent and selective endogenous CB1 receptor agonist with a Ki of 250 nM[1]. N-Arachidonyldopamine is also a potent and selective TRPV1 agonist an with EC50 of ~ 50 nM[2]. |
| Name | (5Z,8Z,11Z,14Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Description | N-Arachidonyldopamine is a potent and selective endogenous CB1 receptor agonist with a Ki of 250 nM[1]. N-Arachidonyldopamine is also a potent and selective TRPV1 agonist an with EC50 of ~ 50 nM[2]. |
|---|---|
| Related Catalog | |
| Target |
CB1:250 nM (Ki) TRPV1:~50 nM (EC50) |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 640.0±55.0 °C at 760 mmHg |
| Molecular Formula | C28H41NO3 |
| Molecular Weight | 439.630 |
| Flash Point | 340.8±31.5 °C |
| Exact Mass | 439.308655 |
| PSA | 69.56000 |
| LogP | 7.07 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | MVVPIAAVGAWJNQ-DOFZRALJSA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCCc1ccc(O)c(O)c1 |
| N-Arachidonoyl dopamine |
| N-Arachidonyl dopamine |
| Arachidonoyl dopamine |
| NADA |
| N-arachidonoyldopamine |
| Arachidonyl dopamine |
| AA-DA |
| (5Z,8Z,11Z,14Z)-N-[2-(3,4-Dihydroxyphenyl)ethyl]-5,8,11,14-icosatetraenamide |
| (5Z,8Z,11Z,14Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]icosa-5,8,11,14-tetraenamide |
| 5,8,11,14-Eicosatetraenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]-, (5Z,8Z,11Z,14Z)- |