Chrysoeriol-7-O-glucoside structure
|
Common Name | Chrysoeriol-7-O-glucoside | ||
|---|---|---|---|---|
| CAS Number | 19993-32-9 | Molecular Weight | 462.404 | |
| Density | 1.609 | Boiling Point | 801.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H22O11 | Melting Point | 176-179 ºC | |
| MSDS | N/A | Flash Point | 281.0±27.8 °C | |
Use of Chrysoeriol-7-O-glucosideThermopsoside is a flavone derivative isolated from Aspalathus linearis. Thermopsoside exhibits inhibitory effects on CYP450 isozymes with IC50 values of 6.0 μM, 9.5 μM, 12.0 μM, 32.0 μM, for CYP3A4, CYP2C19, CYP2D6 and CYP2C9, respectively[1]. |
| Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Thermopsoside is a flavone derivative isolated from Aspalathus linearis. Thermopsoside exhibits inhibitory effects on CYP450 isozymes with IC50 values of 6.0 μM, 9.5 μM, 12.0 μM, 32.0 μM, for CYP3A4, CYP2C19, CYP2D6 and CYP2C9, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.609 |
|---|---|
| Boiling Point | 801.6±65.0 °C at 760 mmHg |
| Melting Point | 176-179 ºC |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.404 |
| Flash Point | 281.0±27.8 °C |
| Exact Mass | 462.116211 |
| PSA | 179.28000 |
| LogP | -0.68 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | GAMYVSCDDLXAQW-MIUGBVLSSA-N |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4O)cc3o2)ccc1O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 4H-1-Benzopyran-4-one, 7-(D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)- |
| 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl D-glucopyranoside |
| Chrysoeriol 7-O-glucoside |