1-(4-Bromophenyl)-2-phenylethanone structure
|
Common Name | 1-(4-Bromophenyl)-2-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 2001-29-8 | Molecular Weight | 275.141 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 383.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H11BrO | Melting Point | 112-116 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 84.6±10.5 °C | |
| Name | 1-(4-bromophenyl)-2-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.2±25.0 °C at 760 mmHg |
| Melting Point | 112-116 °C(lit.) |
| Molecular Formula | C14H11BrO |
| Molecular Weight | 275.141 |
| Flash Point | 84.6±10.5 °C |
| Exact Mass | 273.999329 |
| PSA | 17.07000 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | MOSIKPSTRPODHQ-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1ccc(Br)cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Bromophenyl)-2-phenylethanone |
| 4'-Bromo-2-phenylacetophenone |
| 2-phenyl-4'-bromoacetophenone |
| Benzyl 4-Bromophenyl Ketone |
| 4-bromophenylbenzylmethanone |
| MFCD00016331 |
| 1-(4-bromophenyl)-2-phenylethan-1-one |
| 4-Bromodesoxybenzoin |
| Ethanone, 1-(4-bromophenyl)-2-phenyl- |