Boc-Arg(Pbf)-OH structure
|
Common Name | Boc-Arg(Pbf)-OH | ||
|---|---|---|---|---|
| CAS Number | 200124-22-7 | Molecular Weight | 526.646 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H38N4O7S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Boc-Arg(Pbf)-OHBoc-Arg(Pbf)-OH is an arginine derivative[1]. |
| Name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Arg(Pbf)-OH is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H38N4O7S |
| Molecular Weight | 526.646 |
| Exact Mass | 526.246094 |
| PSA | 175.29000 |
| LogP | 4.91 |
| Index of Refraction | 1.582 |
| InChIKey | CVFXPOKENLGCID-KRWDZBQOSA-N |
| SMILES | Cc1c(C)c(S(=O)(=O)NC(N)=NCCCC(NC(=O)OC(C)(C)C)C(=O)O)c(C)c2c1OC(C)(C)C2 |
| Storage condition | -15°C |
| Water Solubility | Soluble in water or 1% acetic acid |
|
~%
Boc-Arg(Pbf)-OH CAS#:200124-22-7 |
| Literature: WO2013/70688 A1, ; Page/Page column 13; 80; 81 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N|A-Boc-N|O-Pbf-L-arginine |
| L-ornithine, N-[[[(2,3-dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N-[(1,1-dimethylethoxy)carbonyl]- |
| N-(tert-Butoxycarbonyl)-N-{N-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidoyl}-L-ornithine |
| L-Ornithine, N-[amino[[(2,3-dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]methylene]-N-[(1,1-dimethylethoxy)carbonyl]-, (E)- |
| AmbotzBAA1067 |
| Nalpha-Boc-Nomega-Pbf-L-arginine |
| (E)-N-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-ornithine |
| Boc-Arg(Pbf)-OH |