Fmoc-Asp-NH2 structure
|
Common Name | Fmoc-Asp-NH2 | ||
|---|---|---|---|---|
| CAS Number | 200335-40-6 | Molecular Weight | 354.35700 | |
| Density | 1.362g/cm3 | Boiling Point | 662.1ºC at 760 mmHg | |
| Molecular Formula | C19H18N2O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 354.2ºC | |
Use of Fmoc-Asp-NH2Fmoc-Asp-NH2 is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | (3S)-4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Asp-NH2 is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 662.1ºC at 760 mmHg |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.35700 |
| Flash Point | 354.2ºC |
| Exact Mass | 354.12200 |
| PSA | 118.72000 |
| LogP | 2.94490 |
| Vapour Pressure | 1.97E-18mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | VHRMWRHTRSQVJJ-INIZCTEOSA-N |
| SMILES | NC(=O)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Fmoc-L-isoasparagine |
| (S)-3-(((9H-fluoren-9-yl)methoxy)carbonylamino)-4-amino-4-oxobutanoic acid |
| Fmoc-Asp-NH2 |
| Fmoc-IsoAsn-OH |