2-BROMO-4-METHYL-6-NITROPHENOL structure
|
Common Name | 2-BROMO-4-METHYL-6-NITROPHENOL | ||
|---|---|---|---|---|
| CAS Number | 20039-91-2 | Molecular Weight | 232.03100 | |
| Density | 1.755g/cm3 | Boiling Point | 254.1ºC at 760mmHg | |
| Molecular Formula | C7H6BrNO3 | Melting Point | 68ºC | |
| MSDS | N/A | Flash Point | 107.5ºC | |
| Name | 2-Bromo-4-methyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.755g/cm3 |
|---|---|
| Boiling Point | 254.1ºC at 760mmHg |
| Melting Point | 68ºC |
| Molecular Formula | C7H6BrNO3 |
| Molecular Weight | 232.03100 |
| Flash Point | 107.5ºC |
| Exact Mass | 230.95300 |
| PSA | 66.05000 |
| LogP | 2.89450 |
| Vapour Pressure | 0.011mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | ABMPSIRCVCUHLO-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2908999090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| MFCD00060536 |
| 2-bromo-4-methyl-6-nitrophenol |