(2-Amino-5-nitrophenyl)(phenyl)methanone structure
|
Common Name | (2-Amino-5-nitrophenyl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1775-95-7 | Molecular Weight | 242.230 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 478.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H10N2O3 | Melting Point | 166-168 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 242.9±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-5-nitrobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.1±35.0 °C at 760 mmHg |
| Melting Point | 166-168 °C(lit.) |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.230 |
| Flash Point | 242.9±25.9 °C |
| Exact Mass | 242.069138 |
| PSA | 88.91000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | PZPZDEIASIKHPY-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1 |
| Water Solubility | 3 mg/L (20 C) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | PC4935000 |
| HS Code | 2922399090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Structure-activity relationships of novel anti-malarial agents: part 5. N-(4-acylamino-3-benzoylphenyl)-[5-(4-nitrophenyl)-2-furyl]acrylic acid amides.
Bioorg. Med. Chem. Lett. 13(3) , 361-3, (2003) We have developed the [5-(4-nitrophenyl)-2-furyl]acrylic acid substituted benzophenone 4g as a novel lead for anti-malarial agents. Here, we demonstrated that the acyl residue at the 2-amino group of ... |
|
|
Structural features of the 2-amino-5-nitrobenzophenone by means of vibrational spectroscopy HF and DFT, first order hyperpolarizability, NBO, HOMO-LUMO and theromodynamic properties.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 118 , 835-46, (2014) The FT-IR and Raman spectra of 2-amino-5-nitrobenzophenone (ANBP) molecule have been recorded using Brucker IFS 66 V spectrometer in the range of 4000-100 cm(-1). The molecular geometry and vibrationa... |
|
|
Determination of nitrazepam and its main metabolites in urine by thin-layer chromatography and direct densitometry.
J. Chromatogr. A. 339(1) , 163-9, (1985) A method for the direct quantitative densitometry of nitrazepam and its main metabolites (7-aminonitrazepam, 7-acetamidonitrazepam and 2-amino-5-nitrobenzophenone) in urine was developed. The unchange... |
| Ro 7-1999 |
| 2-amino-5-nitro-benzophenone |
| 5-Amino-2-nitrobenzophenone |
| 3-nitro-6-amino-benzophenone |
| IFLAB-BB F0266-0701 |
| 2-Benzoyl-4-nitroaniline |
| Methanone, (2-amino-5-nitrophenyl)phenyl- |
| 5-Nitro-2-aminobenzophenone |
| (2-Amino-5-nitrophenyl)(phenyl)methanone |
| EINECS 217-207-9 |
| MFCD00007364 |
| 2-Amino-5-nitrobenzophenone |
| 2-Amino-5-nitrodiphenylone |