Methanone,bis(4-methoxyphenyl)-,hydrazone structure
|
Common Name | Methanone,bis(4-methoxyphenyl)-,hydrazone | ||
|---|---|---|---|---|
| CAS Number | 20114-55-0 | Molecular Weight | 256.30000 | |
| Density | 1.11g/cm3 | Boiling Point | 399.8ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6ºC | |
| Name | bis(4-methoxyphenyl)methylidenehydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 399.8ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 195.6ºC |
| Exact Mass | 256.12100 |
| PSA | 56.84000 |
| LogP | 3.11520 |
| Vapour Pressure | 1.34E-06mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | PXQXFZBYTZILJD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=NN)c2ccc(OC)cc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~97%
Methanone,bis(4... CAS#:20114-55-0 |
| Literature: Gadhwal, Sunil; Baruah, Mukulesh; Sandhu, Jagir S. Synlett, 1999 , # 10 p. 1573 - 1574 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,4'-dimethoxybenzophenonehydrazone |
| 4,4'-Dimethoxy-benzophenonhydrazon |
| p,p'-Dimethoxy-benzophenon-hydrazon |