Methanone, bis(4-bromophenyl)-, hydrazone structure
|
Common Name | Methanone, bis(4-bromophenyl)-, hydrazone | ||
|---|---|---|---|---|
| CAS Number | 54008-12-7 | Molecular Weight | 354.04000 | |
| Density | 1.67g/cm3 | Boiling Point | 408.5ºC at 760mmHg | |
| Molecular Formula | C13H10Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | bis(4-bromophenyl)methylidenehydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 408.5ºC at 760mmHg |
| Molecular Formula | C13H10Br2N2 |
| Molecular Weight | 354.04000 |
| Flash Point | 200.8ºC |
| Exact Mass | 351.92100 |
| PSA | 38.38000 |
| LogP | 4.62300 |
| Index of Refraction | 1.653 |
| InChIKey | CTSJTEYTCIWTGB-UHFFFAOYSA-N |
| SMILES | NN=C(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,4'-Dibrom-benzophenon-hydrazon |
| 4,4'-dibromo-benzophenone-hydrazone |
| p,p'-Dibrombenzophenonhydrazon |