Methanone,bis(4-ethoxyphenyl)- structure
|
Common Name | Methanone,bis(4-ethoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5032-11-1 | Molecular Weight | 270.32300 | |
| Density | 1.087g/cm3 | Boiling Point | 415.6ºC at 760mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8ºC | |
| Name | bis(4-ethoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 415.6ºC at 760mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 196.8ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.71500 |
| Index of Refraction | 1.545 |
| InChIKey | XZNQFPSOLGYVDO-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)c2ccc(OCC)cc2)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-diethoxybenzophenone |
| 4,4'-Diaethoxy-benzophenon |
| 4,4'-Diethoxy-benzophenon |
| p,p'-Diaethoxybenzophenon |