WYE-176234 structure
|
Common Name | WYE-176234 | ||
|---|---|---|---|---|
| CAS Number | 201284-86-8 | Molecular Weight | 286.32 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 487.0±34.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | 167°C | |
| MSDS | N/A | Flash Point | 179.2±19.2 °C | |
Use of WYE-176234antivirulence agent; antimalarial HDP inhibitor; |
| Name | WYE-176234 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.0±34.0 °C at 760 mmHg |
| Melting Point | 167°C |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32 |
| Flash Point | 179.2±19.2 °C |
| Exact Mass | 286.120514 |
| LogP | 4.63 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | QJGSIWBOOHBIIP-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OCC(=O)c2ccc(O)cc2O)cc1 |
| 1-(2,4-Dihydroxyphenyl)-2-(4-isopropylphenoxy)ethanone |
| Ethanone, 1-(2,4-dihydroxyphenyl)-2-[4-(1-methylethyl)phenoxy]- |
| 1-(2,4-dihydroxyphenyl)-2-(4-isopropylphenoxy)ethan-1-one |
| MFCD00525522 |