chloro-phenoxy-phenyl-sulfanylidene-phosphorane structure
|
Common Name | chloro-phenoxy-phenyl-sulfanylidene-phosphorane | ||
|---|---|---|---|---|
| CAS Number | 20148-06-5 | Molecular Weight | 268.69900 | |
| Density | 1.32g/cm3 | Boiling Point | 356.4ºC at 760mmHg | |
| Molecular Formula | C12H10ClOPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.3ºC | |
| Name | chloro-phenoxy-phenyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 356.4ºC at 760mmHg |
| Molecular Formula | C12H10ClOPS |
| Molecular Weight | 268.69900 |
| Flash Point | 169.3ºC |
| Exact Mass | 267.98800 |
| PSA | 51.13000 |
| LogP | 4.58980 |
| Vapour Pressure | 6.02E-05mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | KJZSIEYIBRWWKS-UHFFFAOYSA-N |
| SMILES | S=P(Cl)(Oc1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~55%
chloro-phenoxy-... CAS#:20148-06-5 |
| Literature: Duddeck, Helmut; Lecht, Rainer Phosphorus and Sulfur and the Related Elements, 1987 , vol. 29, p. 169 - 178 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| chloro-phenoxy-phenyl-sulfanylidene |
| Phenyl-thiophosphonsaeure-chlorid-O-phenylester |
| phenyl(phenoxy)thiophosphonic chloride |
| O-phenyl phenylphosphonothiochloridate |
| phenyl-thiophosphonic acid-chloride O-phenyl ester |
| CHLORO-PHENOXY-PHENYL-SULFANYLIDENE-PHOSPHORANE |
| phenyl phenylthiophosphonochloridate |