N-(phenoxy-phenyl-phosphinothioyl)aniline structure
|
Common Name | N-(phenoxy-phenyl-phosphinothioyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 6276-76-2 | Molecular Weight | 325.36500 | |
| Density | 1.26g/cm3 | Boiling Point | 445.3ºC at 760 mmHg | |
| Molecular Formula | C18H16NOPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
| Name | N-[phenoxy(phenyl)phosphinothioyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 445.3ºC at 760 mmHg |
| Molecular Formula | C18H16NOPS |
| Molecular Weight | 325.36500 |
| Flash Point | 223.1ºC |
| Exact Mass | 325.06900 |
| PSA | 63.16000 |
| LogP | 5.53610 |
| Index of Refraction | 1.66 |
| InChIKey | UHCSMNYRLYIRKR-UHFFFAOYSA-N |
| SMILES | S=P(Nc1ccccc1)(Oc1ccccc1)c1ccccc1 |
|
~%
N-(phenoxy-phen... CAS#:6276-76-2 |
| Literature: Hersman; Audrieth Journal of Organic Chemistry, 1958 , vol. 23, p. 1889,1891 |
|
~%
N-(phenoxy-phen... CAS#:6276-76-2 |
| Literature: Hersman; Audrieth Journal of Organic Chemistry, 1958 , vol. 23, p. 1889,1891 |
|
~%
N-(phenoxy-phen... CAS#:6276-76-2 |
| Literature: Hersman; Audrieth Journal of Organic Chemistry, 1958 , vol. 23, p. 1889,1891 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Phenyl-thiophosphonsaeure-anilid-O-phenylester |
| phenyl-thiophosphonic acid anilide-O-phenyl ester |
| o-phenyl n,p-diphenylphosphonamidothioate |
| Phenylthiophosphonsaeure-O-phenylester-anilid |