N,N-dimethyl-2-nitrobenzamide
N,N-dimethyl-2-nitrobenzamide structure
|
Common Name | N,N-dimethyl-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 2018-71-5 | Molecular Weight | 194.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N2O3 |
|---|---|
| Molecular Weight | 194.18700 |
| Exact Mass | 194.06900 |
| PSA | 66.13000 |
| LogP | 1.81980 |
| InChIKey | KPQZUMNGHBYUOI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccccc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 2 | |
CAS#:6526-66-5
CAS#:88070-48-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N.N-Dimethyl-2-nitro-benzamid |
| 2-nitro-benzoic acid dimethylamide |
| 2-Nitro-benzoesaeure-dimethylamid |
| Benzamide,N,N-dimethyl-2-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N,N-dimethyl-2-nitrobenzamide? |
| A: The English name of N,N-dimethyl-2-nitrobenzamide is N,N-dimethyl-2-nitrobenzamide. |
| Q: What is the LogP of N,N-dimethyl-2-nitrobenzamide? |
| A: LogP of N,N-dimethyl-2-nitrobenzamide is 1.81980. |
| Q: What is the InChIKey of N,N-dimethyl-2-nitrobenzamide? |
| A: InChIKey of N,N-dimethyl-2-nitrobenzamide is KPQZUMNGHBYUOI-UHFFFAOYSA-N. |
| Q: What are the downstream products of N,N-dimethyl-2-nitrobenzamide? |
| A: Related downstream products(CAS) of N,N-dimethyl-2-nitrobenzamide: 6526-66-5;88070-48-8. |
| Q: What is the polar surface area (PSA) of N,N-dimethyl-2-nitrobenzamide? |
| A: Polar surface area (PSA) of N,N-dimethyl-2-nitrobenzamide is 66.13000. |
| Q: What is the Chinese name of 2018-71-5? |
| A: Chinese name of 2018-71-5 is 2018-71-5. |
| Q: What English synonyms does N,N-dimethyl-2-nitrobenzamide have? |
| A: English synonyms of N,N-dimethyl-2-nitrobenzamide: N.N-Dimethyl-2-nitro-benzamid, 2-nitro-benzoic acid dimethylamide, 2-Nitro-benzoesaeure-dimethylamid, Benzamide,N,N-dimethyl-2-nitro. |
| Q: What is the molecular formula of N,N-dimethyl-2-nitrobenzamide? |
| A: Molecular formula of N,N-dimethyl-2-nitrobenzamide is C9H10N2O3. |
| Q: What is the CAS number of N,N-dimethyl-2-nitrobenzamide? |
| A: CAS number of N,N-dimethyl-2-nitrobenzamide is 2018-71-5. |
| Q: What is the molecular weight of N,N-dimethyl-2-nitrobenzamide? |
| A: Molecular weight of N,N-dimethyl-2-nitrobenzamide is 194.18700. |