Cyclohexylcarbamic acid-cyclohexanamine (1:1) structure
|
Common Name | Cyclohexylcarbamic acid-cyclohexanamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 20190-03-8 | Molecular Weight | 242.358 | |
| Density | N/A | Boiling Point | 395ºC at 760mmHg | |
| Molecular Formula | C13H26N2O2 | Melting Point | 112-113 °C | |
| MSDS | N/A | Flash Point | 192.7ºC | |
| Name | Cyclohexylamine carbonate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 395ºC at 760mmHg |
|---|---|
| Melting Point | 112-113 °C |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.358 |
| Flash Point | 192.7ºC |
| Exact Mass | 242.199432 |
| PSA | 75.35000 |
| LogP | 3.95570 |
| Vapour Pressure | 2.42E-07mmHg at 25°C |
| InChIKey | KQIFRYIYNPGWEK-UHFFFAOYSA-N |
| SMILES | NC1CCCCC1.O=C(O)NC1CCCCC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
|
~90%
Cyclohexylcarba... CAS#:20190-03-8 |
| Literature: Aresta; Quaranta Tetrahedron, 1992 , vol. 48, # 8 p. 1515 - 1530 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| cyclohexyl-carbamic acid,compound with cyclohexylamine |
| Cyclohexylammonium N-cyclohexylcarbamate |
| Einecs 243-571-3 |
| Cyclohexyl-carbamidsaeure,Verbindung mit Cyclohexylamin |
| Carbamic acid, cyclohexyl-, compd. with cyclohexanamine (1:1) |
| Cyclohexylcarbamic acid - cyclohexanamine (1:1) |
| cyclohexanaminium cyclohexylcarbamate |
| Cyclohexylammonium cyclohexylcarbamate |
| Carbamic acid, N-cyclohexyl-, compd. with cyclohexanamine (1:1) |
| CHC |