Cyanuric Acid-13C3
Modify Date: 2025-08-26 12:47:51
Cyanuric Acid-13C3 structure
|
Common Name | Cyanuric Acid-13C3 | ||
|---|---|---|---|---|
| CAS Number | 201996-37-4 | Molecular Weight | 132.05200 | |
| Density | 2.004g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C3H3N3O3 | Melting Point | >300ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Cyanuric Acid-13C3 |
|---|---|
| Synonym | More Synonyms |
| Density | 2.004g/cm3 |
|---|---|
| Melting Point | >300ºC |
| Molecular Formula | C3H3N3O3 |
| Molecular Weight | 132.05200 |
| Exact Mass | 132.02800 |
| PSA | 99.36000 |
| Index of Refraction | 1.748 |
| InChIKey | ZFSLODLOARCGLH-VMIGTVKRSA-N |
| SMILES | O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| Storage condition | Refrigerator |
|
~86%
Cyanuric Acid-13C3 CAS#:201996-37-4 |
| Literature: Luo, Yong; Zhang, Liya; Yang, Weicheng; Liu, Weixia; Lu, Weijing; Li, Meihua Journal of Labelled Compounds and Radiopharmaceuticals, 2011 , vol. 54, # 4 p. 171 - 172 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cyanuric acid-13C3 |
| 1,3,5-triazinane-2,4,6-trione |
| 1,3,5-Triazine-2,4,6-triol-13C3,2,4,6-Trihydroxy-1,3,5-triazine-13C3 |