Homopiperazine-1,4-bis(2-ethanesulfonic acid) structure
|
Common Name | Homopiperazine-1,4-bis(2-ethanesulfonic acid) | ||
|---|---|---|---|---|
| CAS Number | 202185-84-0 | Molecular Weight | 316.39500 | |
| Density | 1.447g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H20N2O6S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-[4-(2-sulfoethyl)-1,4-diazepan-1-yl]ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Molecular Formula | C9H20N2O6S2 |
| Molecular Weight | 316.39500 |
| Exact Mass | 316.07600 |
| PSA | 131.98000 |
| LogP | 0.80710 |
| Index of Refraction | 1.555 |
| InChIKey | QZTMPPUJIVQNKS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)CCN1CCCN(CCS(=O)(=O)O)CC1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H312-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | 21-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2585 8/PG 3 |
|
Erwinia amylovora expresses fast and simultaneously hrp/dsp virulence genes during flower infection on apple trees.
PLoS ONE 7 , e32583, (2012) Pathogen entry through host blossoms is the predominant infection pathway of the gram-negative bacterium Erwinia amylovora leading to manifestation of the disease fire blight. Like in other economical... |
| Homo-PIPES |