CPI-203 structure
|
Common Name | CPI-203 | ||
|---|---|---|---|---|
| CAS Number | 202591-23-9 | Molecular Weight | 399.897 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 690.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C19H18ClN5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.4±34.3 °C | |
Use of CPI-203(Rac)-CPI-203 is a racemate of CPI-203 (HY-15846) (BET bromodomain inhibitor)[1] |
| Name | 2-[(6S)-4-(4-Chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | (Rac)-CPI-203 is a racemate of CPI-203 (HY-15846) (BET bromodomain inhibitor)[1] |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 690.5±65.0 °C at 760 mmHg |
| Molecular Formula | C19H18ClN5OS |
| Molecular Weight | 399.897 |
| Flash Point | 371.4±34.3 °C |
| Exact Mass | 399.092072 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | QECMENZMDBOLDR-UHFFFAOYSA-N |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(CC(N)=O)c1nnc(C)n1-2 |
| Storage condition | 2-8℃ |
| 2-[(6S)-4-(4-Chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl]acetamide |
| 6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetamide, 4-(4-chlorophenyl)-2,3,9-trimethyl-, (6S)- |
| 4-(4-Chlorophenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-6-acetamide |
| CPI-203 |