m-PEG6-(CH2)8-phosphonic acid
Modify Date: 2025-08-23 10:47:12
m-PEG6-(CH2)8-phosphonic acid structure
|
Common Name | m-PEG6-(CH2)8-phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 2028284-71-9 | Molecular Weight | 444.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H41O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG6-(CH2)8-phosphonic acidm-PEG6-(CH2)6-Phosphonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | m-PEG6-(CH2)6-Phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG6-(CH2)6-Phosphonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H41O9P |
|---|---|
| Molecular Weight | 444.50 |
| InChIKey | LVZDSZBBOIYSFN-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCCCCCCCP(=O)(O)O |
| MFCD30458009 |