stigmast-5-en-7-on-3§-ol structure
|
Common Name | stigmast-5-en-7-on-3§-ol | ||
|---|---|---|---|---|
| CAS Number | 2034-74-4 | Molecular Weight | 428.690 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 536.1±29.0 °C at 760 mmHg | |
| Molecular Formula | C29H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.1±16.9 °C | |
Use of stigmast-5-en-7-on-3§-ol7-Ketositosterol is a phytosterol isolated from the fruits of the mulberry tree (Morus alba L.). 7-Ketositosterol can significantly inhibit Cisplatin (HY-17394)-induced apoptosis in LLC-PK1 cells and has the potential to improve Cisplatin-induced nephrotoxicity[1]. |
| Name | (3S,8S,9S,10R,13R,14S,17R)-17-((2R,5R)-5-ethyl-6-methylheptan-2-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,10,11,12,13,14,15,16,17-tetradecahydro-7H-cyclopenta[a]phenanthren-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Ketositosterol is a phytosterol isolated from the fruits of the mulberry tree (Morus alba L.). 7-Ketositosterol can significantly inhibit Cisplatin (HY-17394)-induced apoptosis in LLC-PK1 cells and has the potential to improve Cisplatin-induced nephrotoxicity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.1±29.0 °C at 760 mmHg |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.690 |
| Flash Point | 226.1±16.9 °C |
| Exact Mass | 428.365417 |
| PSA | 37.30000 |
| LogP | 8.45 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | ICFXJOAKQGDRCT-ZIHMWMKCSA-N |
| SMILES | CCC(CCC(C)C1CCC2C3C(=O)C=C4CC(O)CCC4(C)C3CCC12C)C(C)C |
| Hazard Codes | Xi |
|---|
| stigmast-5-en-7-on-3§-ol |
| 3§-hydroxystigmast-5-en-7-one |
| Stigmast-5-en-7-one, 3-hydroxy-, (3β)- |
| (3β)-3-Hydroxystigmast-5-en-7-one |